C31H25ClN2OS2 — CID 126113040
(5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-2-phenylimino-3-(3-phenylpropyl)-1,3-thiazolidin-4-one (PubChem CID 126113040) has the molecular formula C31H25ClN2OS2 and a molecular weight of 541.14 g/mol. Its IUPAC name is (5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-2-phenylimino-3-(3-phenylpropyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-2-phenylimino-3-(3-phenylpropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126113040 |
| Molecular Formula | C31H25ClN2OS2 |
| Molecular Weight | 541.14 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | (5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-2-phenylimino-3-(3-phenylpropyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(Sc3ccc(Cl)cc3)cc2)S/C(=N/c2ccccc2)N1CCCc1ccccc1 |
| InChI | InChI=1S/C31H25ClN2OS2/c32-25-15-19-28(20-16-25)36-27-17-13-24(14-18-27)22-29-30(35)34(21-7-10-23-8-3-1-4-9-23)31(37-29)33-26-11-5-2-6-12-26/h1-6,8-9,11-20,22H,7,10,21H2/b29-22-,33-31+ |
| InChIKey | SVWNBGNQWKDZHA-KIMGWWJUSA-N |
| XLogP | 8.73 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.14 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|