C25H26FN3O2S — CID 40989976
(5E)-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 40989976) has the molecular formula C25H26FN3O2S and a molecular weight of 451.57 g/mol. Its IUPAC name is (5E)-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40989976 |
| Molecular Formula | C25H26FN3O2S |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (5E)-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(N3CCCC3)c(F)c2)S/C(=N\c2ccccc2)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C25H26FN3O2S/c26-21-15-18(10-11-22(21)28-12-4-5-13-28)16-23-24(30)29(17-20-9-6-14-31-20)25(32-23)27-19-7-2-1-3-8-19/h1-3,7-8,10-11,15-16,20H,4-6,9,12-14,17H2/b23-16+,27-25-/t20-/m0/s1 |
| InChIKey | MKWBKTNNYMUMAJ-BYRKTNNESA-N |
| XLogP | 5.21 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|