C29H25N3O2S — CID 21374590
(5Z)-5-[(1-naphthalen-2-ylpyrrol-2-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 21374590) has the molecular formula C29H25N3O2S and a molecular weight of 479.61 g/mol. Its IUPAC name is (5Z)-5-[(1-naphthalen-2-ylpyrrol-2-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(1-naphthalen-2-ylpyrrol-2-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21374590 |
| Molecular Formula | C29H25N3O2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (5Z)-5-[(1-naphthalen-2-ylpyrrol-2-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccn2-c2ccc3ccccc3c2)S/C(=N\c2ccccc2)N1CC1CCCO1 |
| InChI | InChI=1S/C29H25N3O2S/c33-28-27(19-24-12-6-16-31(24)25-15-14-21-8-4-5-9-22(21)18-25)35-29(30-23-10-2-1-3-11-23)32(28)20-26-13-7-17-34-26/h1-6,8-12,14-16,18-19,26H,7,13,17,20H2/b27-19-,30-29- |
| InChIKey | VDBVGOLZKUAWQT-OQJTVLEQSA-N |
| XLogP | 6.41 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|