C23H22N2O5S — CID 3729370
5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 3729370) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is 5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3729370 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cc2c(cc1C=C1S/C(=N\c3ccccc3)N(CC3CCCO3)C1=O)OCO2 |
| InChI | InChI=1S/C23H22N2O5S/c1-27-18-12-20-19(29-14-30-20)10-15(18)11-21-22(26)25(13-17-8-5-9-28-17)23(31-21)24-16-6-3-2-4-7-16/h2-4,6-7,10-12,17H,5,8-9,13-14H2,1H3/b21-11?,24-23- |
| InChIKey | LGVFZNPAUPYVNH-KTMSGYBOSA-N |
| XLogP | 4.21 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|