C21H20N2O4S — CID 126058889
(5Z)-2-(3,4-dimethylphenyl)imino-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-methyl-1,3-thiazolidin-4-one (PubChem CID 126058889) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is (5Z)-2-(3,4-dimethylphenyl)imino-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3,4-dimethylphenyl)imino-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126058889 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (5Z)-2-(3,4-dimethylphenyl)imino-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-methyl-1,3-thiazolidin-4-one |
| SMILES | COc1cc2c(cc1/C=C1\S/C(=N/c3ccc(C)c(C)c3)N(C)C1=O)OCO2 |
| InChI | InChI=1S/C21H20N2O4S/c1-12-5-6-15(7-13(12)2)22-21-23(3)20(24)19(28-21)9-14-8-17-18(27-11-26-17)10-16(14)25-4/h5-10H,11H2,1-4H3/b19-9-,22-21+ |
| InChIKey | UAKQQCBGTGOPBS-YIHQBAOTSA-N |
| XLogP | 4.27 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|