C27H24N2O5S — CID 126100241
(5E)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126100241) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is (5E)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126100241 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (5E)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc2c(cc1/C=C1/S/C(=N\c3ccccc3)N(Cc3ccc(OC)cc3)C1=O)OCO2 |
| InChI | InChI=1S/C27H24N2O5S/c1-3-32-22-15-24-23(33-17-34-24)13-19(22)14-25-26(30)29(16-18-9-11-21(31-2)12-10-18)27(35-25)28-20-7-5-4-6-8-20/h4-15H,3,16-17H2,1-2H3/b25-14+,28-27- |
| InChIKey | BLYFLDCCPMHZEL-GZDTXLKOSA-N |
| XLogP | 5.63 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|