C23H26N2O4S — CID 1233200
5-[(2,4-diethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 1233200) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 5-[(2,4-diethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2,4-diethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1233200 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 5-[(2,4-diethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(C=C2S/C(=N\c3ccc(OC)cc3)N(CC)C2=O)c(OCC)c1 |
| InChI | InChI=1S/C23H26N2O4S/c1-5-25-22(26)21(30-23(25)24-17-9-12-18(27-4)13-10-17)14-16-8-11-19(28-6-2)15-20(16)29-7-3/h8-15H,5-7H2,1-4H3/b21-14?,24-23- |
| InChIKey | RTLJLZDGBLFTKC-YLSRMXAHSA-N |
| XLogP | 5.12 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|