C15H13NO7S — CID 126143183
2-[(5E)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126143183) has the molecular formula C15H13NO7S and a molecular weight of 351.34 g/mol. Its IUPAC name is 2-[(5E)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126143183 |
| Molecular Formula | C15H13NO7S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-[(5E)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCOc1cc2c(cc1/C=C1/SC(=O)N(CC(=O)O)C1=O)OCO2 |
| InChI | InChI=1S/C15H13NO7S/c1-2-21-9-5-11-10(22-7-23-11)3-8(9)4-12-14(19)16(6-13(17)18)15(20)24-12/h3-5H,2,6-7H2,1H3,(H,17,18)/b12-4+ |
| InChIKey | YXCDNFGDAAOZCC-UUILKARUSA-N |
| XLogP | 1.93 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|