C20H23NO5S — CID 126152754
(5E)-3-(cyclohexylmethyl)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126152754) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is (5E)-3-(cyclohexylmethyl)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(cyclohexylmethyl)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126152754 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (5E)-3-(cyclohexylmethyl)-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc2c(cc1/C=C1/SC(=O)N(CC3CCCCC3)C1=O)OCO2 |
| InChI | InChI=1S/C20H23NO5S/c1-2-24-15-10-17-16(25-12-26-17)8-14(15)9-18-19(22)21(20(23)27-18)11-13-6-4-3-5-7-13/h8-10,13H,2-7,11-12H2,1H3/b18-9+ |
| InChIKey | STEYOQVACSQKIM-GIJQJNRQSA-N |
| XLogP | 4.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|