C19H23NO4S — CID 126135295
(5E)-3-(cyclohexylmethyl)-5-[(2,3-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126135295) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is (5E)-3-(cyclohexylmethyl)-5-[(2,3-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(cyclohexylmethyl)-5-[(2,3-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126135295 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (5E)-3-(cyclohexylmethyl)-5-[(2,3-dimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cccc(/C=C2/SC(=O)N(CC3CCCCC3)C2=O)c1OC |
| InChI | InChI=1S/C19H23NO4S/c1-23-15-10-6-9-14(17(15)24-2)11-16-18(21)20(19(22)25-16)12-13-7-4-3-5-8-13/h6,9-11,13H,3-5,7-8,12H2,1-2H3/b16-11+ |
| InChIKey | LMUWWVFTEXPYDW-LFIBNONCSA-N |
| XLogP | 4.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|