C24H23Cl2NO3S — CID 126143304
(5E)-3-(cyclohexylmethyl)-5-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126143304) has the molecular formula C24H23Cl2NO3S and a molecular weight of 476.43 g/mol. Its IUPAC name is (5E)-3-(cyclohexylmethyl)-5-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(cyclohexylmethyl)-5-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126143304 |
| Molecular Formula | C24H23Cl2NO3S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (5E)-3-(cyclohexylmethyl)-5-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccccc2OCc2ccc(Cl)c(Cl)c2)C(=O)N1CC1CCCCC1 |
| InChI | InChI=1S/C24H23Cl2NO3S/c25-19-11-10-17(12-20(19)26)15-30-21-9-5-4-8-18(21)13-22-23(28)27(24(29)31-22)14-16-6-2-1-3-7-16/h4-5,8-13,16H,1-3,6-7,14-15H2/b22-13+ |
| InChIKey | WBAPUAVIPJNESK-LPYMAVHISA-N |
| XLogP | 7.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|