C25H24ClNO5S — CID 126155405
3-[[2-chloro-4-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126155405) has the molecular formula C25H24ClNO5S and a molecular weight of 485.99 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126155405 |
| Molecular Formula | C25H24ClNO5S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 3-[[2-chloro-4-[(E)-[3-(cyclohexylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccc(/C=C3/SC(=O)N(CC4CCCCC4)C3=O)cc2Cl)c1 |
| InChI | InChI=1S/C25H24ClNO5S/c26-20-12-17(9-10-21(20)32-15-18-7-4-8-19(11-18)24(29)30)13-22-23(28)27(25(31)33-22)14-16-5-2-1-3-6-16/h4,7-13,16H,1-3,5-6,14-15H2,(H,29,30)/b22-13+ |
| InChIKey | XTPACONKPIJZOL-LPYMAVHISA-N |
| XLogP | 6.23 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|