C23H20ClNO7S — CID 3744075
3-[[2-chloro-4-[[3-(1-ethoxy-1-oxopropan-2-yl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 3744075) has the molecular formula C23H20ClNO7S and a molecular weight of 489.93 g/mol. Its IUPAC name is 3-[[2-chloro-4-[[3-(1-ethoxy-1-oxopropan-2-yl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[[3-(1-ethoxy-1-oxopropan-2-yl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3744075 |
| Molecular Formula | C23H20ClNO7S |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 3-[[2-chloro-4-[[3-(1-ethoxy-1-oxopropan-2-yl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOC(=O)C(C)N1C(=O)SC(=Cc2ccc(OCc3cccc(C(=O)O)c3)c(Cl)c2)C1=O |
| InChI | InChI=1S/C23H20ClNO7S/c1-3-31-22(29)13(2)25-20(26)19(33-23(25)30)11-14-7-8-18(17(24)10-14)32-12-15-5-4-6-16(9-15)21(27)28/h4-11,13H,3,12H2,1-2H3,(H,27,28) |
| InChIKey | OPYLFLYUKYYUQR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|