C22H19BrFNO5S — CID 126019381
ethyl (2R)-2-[(5E)-5-[[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126019381) has the molecular formula C22H19BrFNO5S and a molecular weight of 508.37 g/mol. Its IUPAC name is ethyl (2R)-2-[(5E)-5-[[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2R)-2-[(5E)-5-[[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126019381 |
| Molecular Formula | C22H19BrFNO5S |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | ethyl (2R)-2-[(5E)-5-[[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)N1C(=O)S/C(=C/c2ccc(OCc3cccc(F)c3)c(Br)c2)C1=O |
| InChI | InChI=1S/C22H19BrFNO5S/c1-3-29-21(27)13(2)25-20(26)19(31-22(25)28)11-14-7-8-18(17(23)10-14)30-12-15-5-4-6-16(24)9-15/h4-11,13H,3,12H2,1-2H3/b19-11+/t13-/m1/s1 |
| InChIKey | KTSONOCFHWQLPD-OTGIAGGSSA-N |
| XLogP | 5.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|