C21H16Br2FNO5S — CID 126075817
methyl (2S)-2-[(5E)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126075817) has the molecular formula C21H16Br2FNO5S and a molecular weight of 573.23 g/mol. Its IUPAC name is methyl (2S)-2-[(5E)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[(5E)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126075817 |
| Molecular Formula | C21H16Br2FNO5S |
| Molecular Weight | 573.23 g/mol |
| Exact Mass | 570.91 |
| IUPAC Name | methyl (2S)-2-[(5E)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@H](C)N1C(=O)S/C(=C/c2cc(Br)c(OCc3cccc(F)c3)c(Br)c2)C1=O |
| InChI | InChI=1S/C21H16Br2FNO5S/c1-11(20(27)29-2)25-19(26)17(31-21(25)28)9-13-7-15(22)18(16(23)8-13)30-10-12-4-3-5-14(24)6-12/h3-9,11H,10H2,1-2H3/b17-9+/t11-/m0/s1 |
| InChIKey | KXCBYNNHWPDURK-DTQASYIRSA-N |
| XLogP | 5.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.23 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|