C22H17Br2NO7S — CID 126113018
4-[[2,6-dibromo-4-[(E)-[3-[(2S)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126113018) has the molecular formula C22H17Br2NO7S and a molecular weight of 599.25 g/mol. Its IUPAC name is 4-[[2,6-dibromo-4-[(E)-[3-[(2S)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-dibromo-4-[(E)-[3-[(2S)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126113018 |
| Molecular Formula | C22H17Br2NO7S |
| Molecular Weight | 599.25 g/mol |
| Exact Mass | 596.91 |
| IUPAC Name | 4-[[2,6-dibromo-4-[(E)-[3-[(2S)-1-methoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COC(=O)[C@H](C)N1C(=O)S/C(=C/c2cc(Br)c(OCc3ccc(C(=O)O)cc3)c(Br)c2)C1=O |
| InChI | InChI=1S/C22H17Br2NO7S/c1-11(21(29)31-2)25-19(26)17(33-22(25)30)9-13-7-15(23)18(16(24)8-13)32-10-12-3-5-14(6-4-12)20(27)28/h3-9,11H,10H2,1-2H3,(H,27,28)/b17-9+/t11-/m0/s1 |
| InChIKey | SNFHPBKBSNZNRP-DTQASYIRSA-N |
| XLogP | 5.09 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.25 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|