C21H16BrClN2O7S — CID 126100058
methyl (2S)-2-[(5E)-5-[[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126100058) has the molecular formula C21H16BrClN2O7S and a molecular weight of 555.79 g/mol. Its IUPAC name is methyl (2S)-2-[(5E)-5-[[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[(5E)-5-[[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126100058 |
| Molecular Formula | C21H16BrClN2O7S |
| Molecular Weight | 555.79 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | methyl (2S)-2-[(5E)-5-[[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@H](C)N1C(=O)S/C(=C/c2cc(Cl)c(OCc3ccc([N+](=O)[O-])cc3)c(Br)c2)C1=O |
| InChI | InChI=1S/C21H16BrClN2O7S/c1-11(20(27)31-2)24-19(26)17(33-21(24)28)9-13-7-15(22)18(16(23)8-13)32-10-12-3-5-14(6-4-12)25(29)30/h3-9,11H,10H2,1-2H3/b17-9+/t11-/m0/s1 |
| InChIKey | AOXICFFOJTVIMK-DTQASYIRSA-N |
| XLogP | 5.19 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.79 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|