C22H19ClFNO6S — CID 126074627
methyl (2R)-2-[(5E)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126074627) has the molecular formula C22H19ClFNO6S and a molecular weight of 479.91 g/mol. Its IUPAC name is methyl (2R)-2-[(5E)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(5E)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126074627 |
| Molecular Formula | C22H19ClFNO6S |
| Molecular Weight | 479.91 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | methyl (2R)-2-[(5E)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)N1C(=O)S/C(=C/c2cc(Cl)c(OCc3ccc(F)cc3)c(OC)c2)C1=O |
| InChI | InChI=1S/C22H19ClFNO6S/c1-12(21(27)30-3)25-20(26)18(32-22(25)28)10-14-8-16(23)19(17(9-14)29-2)31-11-13-4-6-15(24)7-5-13/h4-10,12H,11H2,1-3H3/b18-10+/t12-/m1/s1 |
| InChIKey | UDFZQCJSDGLDOR-SGEFVQMOSA-N |
| XLogP | 4.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|