C24H22ClFN2O7S — CID 126016377
ethyl (2S)-2-[(5E)-5-[[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126016377) has the molecular formula C24H22ClFN2O7S and a molecular weight of 536.97 g/mol. Its IUPAC name is ethyl (2S)-2-[(5E)-5-[[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2S)-2-[(5E)-5-[[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126016377 |
| Molecular Formula | C24H22ClFN2O7S |
| Molecular Weight | 536.97 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | ethyl (2S)-2-[(5E)-5-[[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@H](C)N1C(=O)S/C(=C/c2cc(Cl)c(OCC(=O)Nc3ccc(F)cc3)c(OC)c2)C1=O |
| InChI | InChI=1S/C24H22ClFN2O7S/c1-4-34-23(31)13(2)28-22(30)19(36-24(28)32)11-14-9-17(25)21(18(10-14)33-3)35-12-20(29)27-16-7-5-15(26)6-8-16/h5-11,13H,4,12H2,1-3H3,(H,27,29)/b19-11+/t13-/m0/s1 |
| InChIKey | ICYKDVAPMPDUSI-MDBUFAAASA-N |
| XLogP | 4.49 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.97 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|