C26H27ClN2O7S — CID 126027072
ethyl (2R)-2-[(5E)-5-[[3-chloro-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126027072) has the molecular formula C26H27ClN2O7S and a molecular weight of 547.03 g/mol. Its IUPAC name is ethyl (2R)-2-[(5E)-5-[[3-chloro-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2R)-2-[(5E)-5-[[3-chloro-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126027072 |
| Molecular Formula | C26H27ClN2O7S |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | ethyl (2R)-2-[(5E)-5-[[3-chloro-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)N1C(=O)S/C(=C/c2cc(Cl)c(OCC(=O)Nc3ccc(C)cc3)c(OCC)c2)C1=O |
| InChI | InChI=1S/C26H27ClN2O7S/c1-5-34-20-12-17(13-21-24(31)29(26(33)37-21)16(4)25(32)35-6-2)11-19(27)23(20)36-14-22(30)28-18-9-7-15(3)8-10-18/h7-13,16H,5-6,14H2,1-4H3,(H,28,30)/b21-13+/t16-/m1/s1 |
| InChIKey | PVCXEZHLUIADFI-WMRWHDLOSA-N |
| XLogP | 5.05 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|