C25H24FNO6S — CID 126075302
methyl (2S)-2-[(5E)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126075302) has the molecular formula C25H24FNO6S and a molecular weight of 485.53 g/mol. Its IUPAC name is methyl (2S)-2-[(5E)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[(5E)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126075302 |
| Molecular Formula | C25H24FNO6S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | methyl (2S)-2-[(5E)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N([C@@H](C)C(=O)OC)C2=O)cc(OC)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FNO6S/c1-5-6-18-11-17(13-21-23(28)27(25(30)34-21)15(2)24(29)32-4)12-20(31-3)22(18)33-14-16-7-9-19(26)10-8-16/h5,7-13,15H,1,6,14H2,2-4H3/b21-13+/t15-/m0/s1 |
| InChIKey | URBIYZLGQMTLJW-PCXKXAPESA-N |
| XLogP | 4.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|