C27H29NO6S — CID 126090498
methyl (2R)-2-[(5E)-5-[[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126090498) has the molecular formula C27H29NO6S and a molecular weight of 495.60 g/mol. Its IUPAC name is methyl (2R)-2-[(5E)-5-[[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(5E)-5-[[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126090498 |
| Molecular Formula | C27H29NO6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | methyl (2R)-2-[(5E)-5-[[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N([C@H](C)C(=O)OC)C2=O)cc(OCC)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C27H29NO6S/c1-6-8-21-13-20(15-23-25(29)28(27(31)35-23)18(4)26(30)32-5)14-22(33-7-2)24(21)34-16-19-11-9-17(3)10-12-19/h6,9-15,18H,1,7-8,16H2,2-5H3/b23-15+/t18-/m1/s1 |
| InChIKey | BNYKDAMXLMAMEK-MMTNMYCKSA-N |
| XLogP | 5.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|