C27H28FNO6S — CID 126027682
ethyl (2R)-2-[(5E)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126027682) has the molecular formula C27H28FNO6S and a molecular weight of 513.59 g/mol. Its IUPAC name is ethyl (2R)-2-[(5E)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2R)-2-[(5E)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126027682 |
| Molecular Formula | C27H28FNO6S |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | ethyl (2R)-2-[(5E)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N([C@H](C)C(=O)OCC)C2=O)cc(OCC)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FNO6S/c1-5-8-20-13-19(15-23-25(30)29(27(32)36-23)17(4)26(31)34-7-3)14-22(33-6-2)24(20)35-16-18-9-11-21(28)12-10-18/h5,9-15,17H,1,6-8,16H2,2-4H3/b23-15+/t17-/m1/s1 |
| InChIKey | XXCNNBBQMWJOTQ-HAFIMRKLSA-N |
| XLogP | 5.52 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|