C26H25Cl2NO6S — CID 126027278
ethyl (2S)-2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126027278) has the molecular formula C26H25Cl2NO6S and a molecular weight of 550.46 g/mol. Its IUPAC name is ethyl (2S)-2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2S)-2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126027278 |
| Molecular Formula | C26H25Cl2NO6S |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | ethyl (2S)-2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N([C@@H](C)C(=O)OCC)C2=O)cc(OC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H25Cl2NO6S/c1-5-7-17-10-16(12-22-24(30)29(26(32)36-22)15(3)25(31)34-6-2)11-21(33-4)23(17)35-14-18-8-9-19(27)13-20(18)28/h5,8-13,15H,1,6-7,14H2,2-4H3/b22-12+/t15-/m0/s1 |
| InChIKey | SDXIBPGJPFQHLE-OOXYOOLHSA-N |
| XLogP | 6.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|