C25H23Cl2NO6S — CID 126114701
methyl (2R)-2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126114701) has the molecular formula C25H23Cl2NO6S and a molecular weight of 536.43 g/mol. Its IUPAC name is methyl (2R)-2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126114701 |
| Molecular Formula | C25H23Cl2NO6S |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | methyl (2R)-2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N([C@H](C)C(=O)OC)C2=O)cc(OC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H23Cl2NO6S/c1-5-6-17-9-16(12-21-23(29)28(25(31)35-21)14(2)24(30)33-4)11-20(32-3)22(17)34-13-15-7-8-18(26)19(27)10-15/h5,7-12,14H,1,6,13H2,2-4H3/b21-12+/t14-/m1/s1 |
| InChIKey | XAXGTGOKPZPGMX-STCDJXRXSA-N |
| XLogP | 5.91 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|