C24H24FNO5S — CID 126135540
(5E)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126135540) has the molecular formula C24H24FNO5S and a molecular weight of 457.52 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126135540 |
| Molecular Formula | C24H24FNO5S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (5E)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N(CCOC)C2=O)cc(OC)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FNO5S/c1-4-5-18-12-17(14-21-23(27)26(10-11-29-2)24(28)32-21)13-20(30-3)22(18)31-15-16-6-8-19(25)9-7-16/h4,6-9,12-14H,1,5,10-11,15H2,2-3H3/b21-14+ |
| InChIKey | GAVODZSBOZEJGZ-KGENOOAVSA-N |
| XLogP | 4.82 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|