C23H21BrN2O8S — CID 126015524
ethyl (2S)-2-[(5E)-5-[[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126015524) has the molecular formula C23H21BrN2O8S and a molecular weight of 565.40 g/mol. Its IUPAC name is ethyl (2S)-2-[(5E)-5-[[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2S)-2-[(5E)-5-[[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126015524 |
| Molecular Formula | C23H21BrN2O8S |
| Molecular Weight | 565.40 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | ethyl (2S)-2-[(5E)-5-[[3-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@H](C)N1C(=O)S/C(=C/c2cc(Br)c(OCc3ccc([N+](=O)[O-])cc3)c(OC)c2)C1=O |
| InChI | InChI=1S/C23H21BrN2O8S/c1-4-33-22(28)13(2)25-21(27)19(35-23(25)29)11-15-9-17(24)20(18(10-15)32-3)34-12-14-5-7-16(8-6-14)26(30)31/h5-11,13H,4,12H2,1-3H3/b19-11+/t13-/m0/s1 |
| InChIKey | AKIJIZOCFXRQIU-MDBUFAAASA-N |
| XLogP | 4.93 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|