C19H22BrNO5S — CID 126017406
ethyl (2S)-2-[(5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126017406) has the molecular formula C19H22BrNO5S and a molecular weight of 456.36 g/mol. Its IUPAC name is ethyl (2S)-2-[(5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2S)-2-[(5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126017406 |
| Molecular Formula | C19H22BrNO5S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | ethyl (2S)-2-[(5E)-5-[[3-bromo-4-[(2S)-butan-2-yl]oxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@H](C)N1C(=O)S/C(=C/c2ccc(O[C@@H](C)CC)c(Br)c2)C1=O |
| InChI | InChI=1S/C19H22BrNO5S/c1-5-11(3)26-15-8-7-13(9-14(15)20)10-16-17(22)21(19(24)27-16)12(4)18(23)25-6-2/h7-12H,5-6H2,1-4H3/b16-10+/t11-,12-/m0/s1 |
| InChIKey | LQIQCNXNRRXQHH-ATARQRRYSA-N |
| XLogP | 4.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|