C16H17NO6S — CID 75338987
ethyl 2-[5-[(2,3-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 75338987) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is ethyl 2-[5-[(2,3-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[5-[(2,3-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 75338987 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | ethyl 2-[5-[(2,3-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)SC(=Cc2cccc(OC)c2OC)C1=O |
| InChI | InChI=1S/C16H17NO6S/c1-4-23-13(18)9-17-15(19)12(24-16(17)20)8-10-6-5-7-11(21-2)14(10)22-3/h5-8H,4,9H2,1-3H3 |
| InChIKey | PEDLHGYPKRHSGE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|