C17H16NO8S- — CID 7323920
2-[2-[(E)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 7323920) has the molecular formula C17H16NO8S- and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-[2-[(E)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | 2-[2-[(E)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 7323920 |
| Molecular Formula | C17H16NO8S- |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-[2-[(E)-[3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C/c2cccc(OC)c2OCC(=O)[O-])C1=O |
| InChI | InChI=1S/C17H17NO8S/c1-3-25-14(21)8-18-16(22)12(27-17(18)23)7-10-5-4-6-11(24-2)15(10)26-9-13(19)20/h4-7H,3,8-9H2,1-2H3,(H,19,20)/p-1/b12-7+ |
| InChIKey | ZAEOSZCIYNYZKG-KPKJPENVSA-M |
| XLogP | 0.42 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|