C16H16NO5S2- — CID 9153006
2-[(5Z)-5-[(3-methoxy-2-propoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 9153006) has the molecular formula C16H16NO5S2- and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-methoxy-2-propoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[(5Z)-5-[(3-methoxy-2-propoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 9153006 |
| Molecular Formula | C16H16NO5S2- |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2-[(5Z)-5-[(3-methoxy-2-propoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCOc1c(/C=C2\SC(=S)N(CC(=O)[O-])C2=O)cccc1OC |
| InChI | InChI=1S/C16H17NO5S2/c1-3-7-22-14-10(5-4-6-11(14)21-2)8-12-15(20)17(9-13(18)19)16(23)24-12/h4-6,8H,3,7,9H2,1-2H3,(H,18,19)/p-1/b12-8- |
| InChIKey | CAPLBZUNUJBIND-WQLSENKSSA-M |
| XLogP | 1.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|