C15H14BrNO6S — CID 2264454
ethyl 2-[(5Z)-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 2264454) has the molecular formula C15H14BrNO6S and a molecular weight of 416.25 g/mol. Its IUPAC name is ethyl 2-[(5Z)-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5Z)-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 2264454 |
| Molecular Formula | C15H14BrNO6S |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | ethyl 2-[(5Z)-5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C\c2cc(Br)cc(OC)c2O)C1=O |
| InChI | InChI=1S/C15H14BrNO6S/c1-3-23-12(18)7-17-14(20)11(24-15(17)21)5-8-4-9(16)6-10(22-2)13(8)19/h4-6,19H,3,7H2,1-2H3/b11-5- |
| InChIKey | VVUZMGSJFYAKJP-WZUFQYTHSA-N |
| XLogP | 2.76 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|