C16H17NO6S — CID 3452487
4-[5-[(2,3-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 3452487) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is 4-[5-[(2,3-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[(2,3-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 3452487 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-[5-[(2,3-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | COc1cccc(C=C2SC(=O)N(CCCC(=O)O)C2=O)c1OC |
| InChI | InChI=1S/C16H17NO6S/c1-22-11-6-3-5-10(14(11)23-2)9-12-15(20)17(16(21)24-12)8-4-7-13(18)19/h3,5-6,9H,4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | DSNLIHMZAPXXMX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|