C20H14ClNO7S — CID 66485427
2-[(5E)-5-[[2-(2-chlorobenzoyl)oxy-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 66485427) has the molecular formula C20H14ClNO7S and a molecular weight of 447.85 g/mol. Its IUPAC name is 2-[(5E)-5-[[2-(2-chlorobenzoyl)oxy-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[2-(2-chlorobenzoyl)oxy-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66485427 |
| Molecular Formula | C20H14ClNO7S |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | 2-[(5E)-5-[[2-(2-chlorobenzoyl)oxy-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1cccc(/C=C2/SC(=O)N(CC(=O)O)C2=O)c1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H14ClNO7S/c1-28-14-8-4-5-11(9-15-18(25)22(10-16(23)24)20(27)30-15)17(14)29-19(26)12-6-2-3-7-13(12)21/h2-9H,10H2,1H3,(H,23,24)/b15-9+ |
| InChIKey | QVWQIIDCTWXHPS-OQLLNIDSSA-N |
| XLogP | 3.69 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|