C18H18N2O6S — CID 78414923
5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 78414923) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is 5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 78414923 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc2c(cc1C=C1SC(=O)N(CC(=O)N3CCCC3)C1=O)OCO2 |
| InChI | InChI=1S/C18H18N2O6S/c1-24-12-8-14-13(25-10-26-14)6-11(12)7-15-17(22)20(18(23)27-15)9-16(21)19-4-2-3-5-19/h6-8H,2-5,9-10H2,1H3 |
| InChIKey | LYVVOYDGRVTAJW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|