C23H29N3O5S — CID 4553977
5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 4553977) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is 5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4553977 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 5-[(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(N2CCCC2)c(OC)cc1C=C1SC(=O)N(CC(=O)N2CCCCC2)C1=O |
| InChI | InChI=1S/C23H29N3O5S/c1-30-18-14-17(24-8-6-7-9-24)19(31-2)12-16(18)13-20-22(28)26(23(29)32-20)15-21(27)25-10-4-3-5-11-25/h12-14H,3-11,15H2,1-2H3 |
| InChIKey | BZQGRTXBFAAVAS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|