C25H21N3O6S — CID 1208876
5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 1208876) has the molecular formula C25H21N3O6S and a molecular weight of 491.53 g/mol. Its IUPAC name is 5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1208876 |
| Molecular Formula | C25H21N3O6S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 5-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)C(=Cc3cc([N+](=O)[O-])cc(OC)c3O)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3O6S/c1-33-20-10-8-16(9-11-20)15-27-24(30)22(35-25(27)26-18-6-4-3-5-7-18)13-17-12-19(28(31)32)14-21(34-2)23(17)29/h3-14,29H,15H2,1-2H3/b22-13?,26-25- |
| InChIKey | YVXLGFUXYYGPPA-PISSCQFASA-N |
| XLogP | 5.12 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|