C34H28N4O4S — CID 6309679
(5Z)-3-[(4-methoxyphenyl)methyl]-5-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 6309679) has the molecular formula C34H28N4O4S and a molecular weight of 588.69 g/mol. Its IUPAC name is (5Z)-3-[(4-methoxyphenyl)methyl]-5-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(4-methoxyphenyl)methyl]-5-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6309679 |
| Molecular Formula | C34H28N4O4S |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | (5Z)-3-[(4-methoxyphenyl)methyl]-5-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)/C(=C/c3c(C)n(Cc4ccc([N+](=O)[O-])cc4)c4ccccc34)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C34H28N4O4S/c1-23-30(29-10-6-7-11-31(29)36(23)21-24-12-16-27(17-13-24)38(40)41)20-32-33(39)37(22-25-14-18-28(42-2)19-15-25)34(43-32)35-26-8-4-3-5-9-26/h3-20H,21-22H2,1-2H3/b32-20-,35-34- |
| InChIKey | NDOXERREIHIFJT-NIIBPYQZSA-N |
| XLogP | 7.72 |
| TPSA | 89.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|