C28H21ClN4O5S — CID 126251416
N-(2-chlorophenyl)-2-[(5E)-5-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126251416) has the molecular formula C28H21ClN4O5S and a molecular weight of 561.02 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(5E)-5-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[(5E)-5-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126251416 |
| Molecular Formula | C28H21ClN4O5S |
| Molecular Weight | 561.02 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(5E)-5-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1c(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3Cl)C2=O)c2ccccc2n1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H21ClN4O5S/c1-17-21(20-6-2-5-9-24(20)31(17)15-18-10-12-19(13-11-18)33(37)38)14-25-27(35)32(28(36)39-25)16-26(34)30-23-8-4-3-7-22(23)29/h2-14H,15-16H2,1H3,(H,30,34)/b25-14+ |
| InChIKey | PLUDVOHFIBYRPT-AFUMVMLFSA-N |
| XLogP | 6.23 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.02 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|