C25H19N3O2S — CID 6343438
(5E)-3-(furan-2-ylmethyl)-2-phenylimino-5-[(1-phenylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 6343438) has the molecular formula C25H19N3O2S and a molecular weight of 425.51 g/mol. Its IUPAC name is (5E)-3-(furan-2-ylmethyl)-2-phenylimino-5-[(1-phenylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(furan-2-ylmethyl)-2-phenylimino-5-[(1-phenylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6343438 |
| Molecular Formula | C25H19N3O2S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | (5E)-3-(furan-2-ylmethyl)-2-phenylimino-5-[(1-phenylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cccn2-c2ccccc2)S/C(=N\c2ccccc2)N1Cc1ccco1 |
| InChI | InChI=1S/C25H19N3O2S/c29-24-23(17-21-13-7-15-27(21)20-11-5-2-6-12-20)31-25(26-19-9-3-1-4-10-19)28(24)18-22-14-8-16-30-22/h1-17H,18H2/b23-17+,26-25- |
| InChIKey | QPCAXJZBLTYCSM-OBUXZSPNSA-N |
| XLogP | 5.87 |
| TPSA | 50.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|