C25H18N4O2S — CID 4675388
2-[3-[[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetonitrile (PubChem CID 4675388) has the molecular formula C25H18N4O2S and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-[3-[[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetonitrile.
| Compound Name | 2-[3-[[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 4675388 |
| Molecular Formula | C25H18N4O2S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-[3-[[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetonitrile |
| SMILES | N#CCn1cc(C=C2S/C(=N\c3ccccc3)N(Cc3ccco3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C25H18N4O2S/c26-12-13-28-16-18(21-10-4-5-11-22(21)28)15-23-24(30)29(17-20-9-6-14-31-20)25(32-23)27-19-7-2-1-3-8-19/h1-11,14-16H,13,17H2/b23-15?,27-25- |
| InChIKey | BISMDSGRDIENSB-WTNMUKLWSA-N |
| XLogP | 5.56 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|