C30H23N3O5S — CID 126397830
methyl 5-[[3-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate (PubChem CID 126397830) has the molecular formula C30H23N3O5S and a molecular weight of 537.60 g/mol. Its IUPAC name is methyl 5-[[3-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[3-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126397830 |
| Molecular Formula | C30H23N3O5S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | methyl 5-[[3-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2cc(/C=C3\S/C(=N\c4ccccc4)N(Cc4ccco4)C3=O)c3ccccc32)o1 |
| InChI | InChI=1S/C30H23N3O5S/c1-36-29(35)26-14-13-23(38-26)18-32-17-20(24-11-5-6-12-25(24)32)16-27-28(34)33(19-22-10-7-15-37-22)30(39-27)31-21-8-3-2-4-9-21/h2-17H,18-19H2,1H3/b27-16-,31-30- |
| InChIKey | PQDQSIFGZKNAKY-ZHELPIKKSA-N |
| XLogP | 6.47 |
| TPSA | 90.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|