C25H18N2O5S — CID 126395296
methyl 5-[[3-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]furan-2-carboxylate (PubChem CID 126395296) has the molecular formula C25H18N2O5S and a molecular weight of 458.50 g/mol. Its IUPAC name is methyl 5-[[3-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[3-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126395296 |
| Molecular Formula | C25H18N2O5S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | methyl 5-[[3-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2cc(/C=C3\SC(=O)N(c4ccccc4)C3=O)c3ccccc32)o1 |
| InChI | InChI=1S/C25H18N2O5S/c1-31-24(29)21-12-11-18(32-21)15-26-14-16(19-9-5-6-10-20(19)26)13-22-23(28)27(25(30)33-22)17-7-3-2-4-8-17/h2-14H,15H2,1H3/b22-13- |
| InChIKey | GUWATSWFHYVMPU-XKZIYDEJSA-N |
| XLogP | 5.31 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|