C27H21N3O6 — CID 126396663
methyl 5-[[3-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate (PubChem CID 126396663) has the molecular formula C27H21N3O6 and a molecular weight of 483.48 g/mol. Its IUPAC name is methyl 5-[[3-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[3-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126396663 |
| Molecular Formula | C27H21N3O6 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | methyl 5-[[3-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2cc(/C=C3\C(=O)NC(=O)N(c4ccc(C)cc4)C3=O)c3ccccc32)o1 |
| InChI | InChI=1S/C27H21N3O6/c1-16-7-9-18(10-8-16)30-25(32)21(24(31)28-27(30)34)13-17-14-29(22-6-4-3-5-20(17)22)15-19-11-12-23(36-19)26(33)35-2/h3-14H,15H2,1-2H3,(H,28,31,34)/b21-13+ |
| InChIKey | LFJHNQRPKSXRHN-FYJGNVAPSA-N |
| XLogP | 4.04 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|