C22H18N4O4 — CID 6378027
2-[3-[(Z)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 6378027) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is 2-[3-[(Z)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | 2-[3-[(Z)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 6378027 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[3-[(Z)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)NC(=O)/C(=C/c3cn(CC(N)=O)c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C22H18N4O4/c1-13-6-8-15(9-7-13)26-21(29)17(20(28)24-22(26)30)10-14-11-25(12-19(23)27)18-5-3-2-4-16(14)18/h2-11H,12H2,1H3,(H2,23,27)(H,24,28,30)/b17-10- |
| InChIKey | LTBAXSPEQCPEGO-YVLHZVERSA-N |
| XLogP | 2.10 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|