C31H24N4O4S — CID 126396129
methyl 5-[[3-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate (PubChem CID 126396129) has the molecular formula C31H24N4O4S and a molecular weight of 548.62 g/mol. Its IUPAC name is methyl 5-[[3-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[3-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126396129 |
| Molecular Formula | C31H24N4O4S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | methyl 5-[[3-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2cc(/C=C3\S/C(=N\c4ccccc4)N(Cc4cccnc4)C3=O)c3ccccc32)o1 |
| InChI | InChI=1S/C31H24N4O4S/c1-38-30(37)27-14-13-24(39-27)20-34-19-22(25-11-5-6-12-26(25)34)16-28-29(36)35(18-21-8-7-15-32-17-21)31(40-28)33-23-9-3-2-4-10-23/h2-17,19H,18,20H2,1H3/b28-16-,33-31- |
| InChIKey | IVOOIHHXIYUBOS-XSLNYXNTSA-N |
| XLogP | 6.27 |
| TPSA | 89.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|