C30H25N3O4S — CID 126161037
propan-2-yl 3-[5-[(E)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126161037) has the molecular formula C30H25N3O4S and a molecular weight of 523.61 g/mol. Its IUPAC name is propan-2-yl 3-[5-[(E)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | propan-2-yl 3-[5-[(E)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126161037 |
| Molecular Formula | C30H25N3O4S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | propan-2-yl 3-[5-[(E)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CC(C)OC(=O)c1cccc(-c2ccc(/C=C3/S/C(=N\c4ccccc4)N(Cc4cccnc4)C3=O)o2)c1 |
| InChI | InChI=1S/C30H25N3O4S/c1-20(2)36-29(35)23-10-6-9-22(16-23)26-14-13-25(37-26)17-27-28(34)33(19-21-8-7-15-31-18-21)30(38-27)32-24-11-4-3-5-12-24/h3-18,20H,19H2,1-2H3/b27-17+,32-30- |
| InChIKey | OXQWQFULCYCVHW-FLNDSNKGSA-N |
| XLogP | 6.71 |
| TPSA | 85.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|