C28H28N2O4S — CID 126158007
propan-2-yl 3-[5-[(E)-[3-(2-methylpropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126158007) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is propan-2-yl 3-[5-[(E)-[3-(2-methylpropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | propan-2-yl 3-[5-[(E)-[3-(2-methylpropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126158007 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | propan-2-yl 3-[5-[(E)-[3-(2-methylpropyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CC(C)CN1C(=O)/C(=C\c2ccc(-c3cccc(C(=O)OC(C)C)c3)o2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C28H28N2O4S/c1-18(2)17-30-26(31)25(35-28(30)29-22-11-6-5-7-12-22)16-23-13-14-24(34-23)20-9-8-10-21(15-20)27(32)33-19(3)4/h5-16,18-19H,17H2,1-4H3/b25-16+,29-28- |
| InChIKey | IRIPPRRBTJWOGT-CIKNCDAESA-N |
| XLogP | 6.77 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|