C28H26N2O6S — CID 5240678
propyl 3-[5-[[2-(3-ethoxycarbonylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 5240678) has the molecular formula C28H26N2O6S and a molecular weight of 518.59 g/mol. Its IUPAC name is propyl 3-[5-[[2-(3-ethoxycarbonylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | propyl 3-[5-[[2-(3-ethoxycarbonylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 5240678 |
| Molecular Formula | C28H26N2O6S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | propyl 3-[5-[[2-(3-ethoxycarbonylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCCOC(=O)c1cccc(-c2ccc(C=C3S/C(=N/c4cccc(C(=O)OCC)c4)N(C)C3=O)o2)c1 |
| InChI | InChI=1S/C28H26N2O6S/c1-4-14-35-27(33)19-9-6-8-18(15-19)23-13-12-22(36-23)17-24-25(31)30(3)28(37-24)29-21-11-7-10-20(16-21)26(32)34-5-2/h6-13,15-17H,4-5,14H2,1-3H3/b24-17?,29-28+ |
| InChIKey | LIZDRXAWOSYBJA-MBALZVFKSA-N |
| XLogP | 5.92 |
| TPSA | 98.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|