C20H20N2O4S — CID 9485486
propyl 3-[[(5E)-3-ethyl-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 9485486) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is propyl 3-[[(5E)-3-ethyl-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | propyl 3-[[(5E)-3-ethyl-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 9485486 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | propyl 3-[[(5E)-3-ethyl-5-(furan-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCCOC(=O)c1cccc(/N=C2/S/C(=C/c3ccco3)C(=O)N2CC)c1 |
| InChI | InChI=1S/C20H20N2O4S/c1-3-10-26-19(24)14-7-5-8-15(12-14)21-20-22(4-2)18(23)17(27-20)13-16-9-6-11-25-16/h5-9,11-13H,3-4,10H2,1-2H3/b17-13+,21-20+ |
| InChIKey | GFWBIJZFTWZPFX-NLIDQGKYSA-N |
| XLogP | 4.47 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|